C19H22FNOS — CID 47005981
N-[1-(4-fluorophenyl)ethyl]-2-(3-phenylpropylsulfanyl)acetamide (PubChem CID 47005981) has the molecular formula C19H22FNOS and a molecular weight of 331.46 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethyl]-2-(3-phenylpropylsulfanyl)acetamide.
| Compound Name | N-[1-(4-fluorophenyl)ethyl]-2-(3-phenylpropylsulfanyl)acetamide |
|---|---|
| PubChem CID | 47005981 |
| Molecular Formula | C19H22FNOS |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethyl]-2-(3-phenylpropylsulfanyl)acetamide |
| SMILES | CC(NC(=O)CSCCCc1ccccc1)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H22FNOS/c1-15(17-9-11-18(20)12-10-17)21-19(22)14-23-13-5-8-16-6-3-2-4-7-16/h2-4,6-7,9-12,15H,5,8,13-14H2,1H3,(H,21,22) |
| InChIKey | MRYKMBZRFWIYAV-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|