C17H17F2NOS — CID 132650849
N-[1-(4-fluorophenyl)ethyl]-2-[(2-fluorophenyl)methylsulfanyl]acetamide (PubChem CID 132650849) has the molecular formula C17H17F2NOS and a molecular weight of 321.39 g/mol. Its IUPAC name is N-[1-(4-fluorophenyl)ethyl]-2-[(2-fluorophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[1-(4-fluorophenyl)ethyl]-2-[(2-fluorophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 132650849 |
| Molecular Formula | C17H17F2NOS |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.10 |
| IUPAC Name | N-[1-(4-fluorophenyl)ethyl]-2-[(2-fluorophenyl)methylsulfanyl]acetamide |
| SMILES | CC(NC(=O)CSCc1ccccc1F)c1ccc(F)cc1 |
| InChI | InChI=1S/C17H17F2NOS/c1-12(13-6-8-15(18)9-7-13)20-17(21)11-22-10-14-4-2-3-5-16(14)19/h2-9,12H,10-11H2,1H3,(H,20,21) |
| InChIKey | KXVZHFUUFFAPDS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |