C13H21ClFN5 — CID 159346485
2-(N,N-dimethylcarbamimidoyl)-1-[2-(4-fluorophenyl)ethyl]-1-methylguanidine;hydrochloride (PubChem CID 159346485) has the molecular formula C13H21ClFN5 and a molecular weight of 301.80 g/mol. Its IUPAC name is 2-(N,N-dimethylcarbamimidoyl)-1-[2-(4-fluorophenyl)ethyl]-1-methylguanidine;hydrochloride.
| Compound Name | 2-(N,N-dimethylcarbamimidoyl)-1-[2-(4-fluorophenyl)ethyl]-1-methylguanidine;hydrochloride |
|---|---|
| PubChem CID | 159346485 |
| Molecular Formula | C13H21ClFN5 |
| Molecular Weight | 301.80 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 2-(N,N-dimethylcarbamimidoyl)-1-[2-(4-fluorophenyl)ethyl]-1-methylguanidine;hydrochloride |
| SMILES | Cl.[H]/N=C(/N=C(N)N(C)CCc1ccc(F)cc1)N(C)C |
| InChI | InChI=1S/C13H20FN5.ClH/c1-18(2)12(15)17-13(16)19(3)9-8-10-4-6-11(14)7-5-10;/h4-7H,8-9H2,1-3H3,(H3,15,16,17);1H |
| InChIKey | JGAFRJNKELLLRQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 68.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.80 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|