C12H19N5 — CID 123140096
1-methyl-2-(N'-methylcarbamimidoyl)-1-(2-phenylethyl)guanidine (PubChem CID 123140096) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 1-methyl-2-(N'-methylcarbamimidoyl)-1-(2-phenylethyl)guanidine.
| Compound Name | 1-methyl-2-(N'-methylcarbamimidoyl)-1-(2-phenylethyl)guanidine |
|---|---|
| PubChem CID | 123140096 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 1-methyl-2-(N'-methylcarbamimidoyl)-1-(2-phenylethyl)guanidine |
| SMILES | C/N=C(\N)N=C(N)N(C)CCc1ccccc1 |
| InChI | InChI=1S/C12H19N5/c1-15-11(13)16-12(14)17(2)9-8-10-6-4-3-5-7-10/h3-7H,8-9H2,1-2H3,(H4,13,14,15,16) |
| InChIKey | QHBAZQKZTZUYGK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 80.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|