C11H15N3O2 — CID 23220
3-carbamoyl-1-methyl-1-(2-phenylethyl)urea (PubChem CID 23220) has the molecular formula C11H15N3O2 and a molecular weight of 221.26 g/mol. Its IUPAC name is 3-carbamoyl-1-methyl-1-(2-phenylethyl)urea.
| Compound Name | 3-carbamoyl-1-methyl-1-(2-phenylethyl)urea |
|---|---|
| PubChem CID | 23220 |
| Molecular Formula | C11H15N3O2 |
| Molecular Weight | 221.26 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 3-carbamoyl-1-methyl-1-(2-phenylethyl)urea |
| SMILES | CN(CCc1ccccc1)C(=O)NC(N)=O |
| InChI | InChI=1S/C11H15N3O2/c1-14(11(16)13-10(12)15)8-7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H3,12,13,15,16) |
| InChIKey | BJMYAMSLFPKKNG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.26 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |