C13H15NO4 — CID 142214555
4-[methyl(2-phenylethyl)amino]-2,4-dioxobutanoic acid (PubChem CID 142214555) has the molecular formula C13H15NO4 and a molecular weight of 249.27 g/mol. Its IUPAC name is 4-[methyl(2-phenylethyl)amino]-2,4-dioxobutanoic acid.
| Compound Name | 4-[methyl(2-phenylethyl)amino]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 142214555 |
| Molecular Formula | C13H15NO4 |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.10 |
| IUPAC Name | 4-[methyl(2-phenylethyl)amino]-2,4-dioxobutanoic acid |
| SMILES | CN(CCc1ccccc1)C(=O)CC(=O)C(=O)O |
| InChI | InChI=1S/C13H15NO4/c1-14(12(16)9-11(15)13(17)18)8-7-10-5-3-2-4-6-10/h2-6H,7-9H2,1H3,(H,17,18) |
| InChIKey | ZQZCNCFWQGEMHM-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|