C18H17NO5 — CID 90685468
4-[methyl-[(3-phenoxyphenyl)methyl]amino]-2,4-dioxobutanoic acid (PubChem CID 90685468) has the molecular formula C18H17NO5 and a molecular weight of 327.34 g/mol. Its IUPAC name is 4-[methyl-[(3-phenoxyphenyl)methyl]amino]-2,4-dioxobutanoic acid.
| Compound Name | 4-[methyl-[(3-phenoxyphenyl)methyl]amino]-2,4-dioxobutanoic acid |
|---|---|
| PubChem CID | 90685468 |
| Molecular Formula | C18H17NO5 |
| Molecular Weight | 327.34 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 4-[methyl-[(3-phenoxyphenyl)methyl]amino]-2,4-dioxobutanoic acid |
| SMILES | CN(Cc1cccc(Oc2ccccc2)c1)C(=O)CC(=O)C(=O)O |
| InChI | InChI=1S/C18H17NO5/c1-19(17(21)11-16(20)18(22)23)12-13-6-5-9-15(10-13)24-14-7-3-2-4-8-14/h2-10H,11-12H2,1H3,(H,22,23) |
| InChIKey | GPEHQYBODBMHRD-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.34 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|