C10H19N3 — CID 159470324
N,N-dimethyl-2-phenylethanamine;hydrazine (PubChem CID 159470324) has the molecular formula C10H19N3 and a molecular weight of 181.28 g/mol. Its IUPAC name is N,N-dimethyl-2-phenylethanamine;hydrazine.
| Compound Name | N,N-dimethyl-2-phenylethanamine;hydrazine |
|---|---|
| PubChem CID | 159470324 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | N,N-dimethyl-2-phenylethanamine;hydrazine |
| SMILES | CN(C)CCc1ccccc1.NN |
| InChI | InChI=1S/C10H15N.H4N2/c1-11(2)9-8-10-6-4-3-5-7-10;1-2/h3-7H,8-9H2,1-2H3;1-2H2 |
| InChIKey | LVSIDVXJSNVXEW-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 55.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|