C14H20FN3O2S — CID 86779416
N'-[2-(4-fluorophenyl)sulfonylethyl]piperidine-1-carboximidamide (PubChem CID 86779416) has the molecular formula C14H20FN3O2S and a molecular weight of 313.40 g/mol. Its IUPAC name is N'-[2-(4-fluorophenyl)sulfonylethyl]piperidine-1-carboximidamide.
| Compound Name | N'-[2-(4-fluorophenyl)sulfonylethyl]piperidine-1-carboximidamide |
|---|---|
| PubChem CID | 86779416 |
| Molecular Formula | C14H20FN3O2S |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.13 |
| IUPAC Name | N'-[2-(4-fluorophenyl)sulfonylethyl]piperidine-1-carboximidamide |
| SMILES | N/C(=N\CCS(=O)(=O)c1ccc(F)cc1)N1CCCCC1 |
| InChI | InChI=1S/C14H20FN3O2S/c15-12-4-6-13(7-5-12)21(19,20)11-8-17-14(16)18-9-2-1-3-10-18/h4-7H,1-3,8-11H2,(H2,16,17) |
| InChIKey | PYYKQWWCAVJYKE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 75.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|