C13H19N3O3S — CID 111065084
N'-[2-(benzenesulfonyl)ethyl]morpholine-4-carboximidamide (PubChem CID 111065084) has the molecular formula C13H19N3O3S and a molecular weight of 297.38 g/mol. Its IUPAC name is N'-[2-(benzenesulfonyl)ethyl]morpholine-4-carboximidamide.
| Compound Name | N'-[2-(benzenesulfonyl)ethyl]morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111065084 |
| Molecular Formula | C13H19N3O3S |
| Molecular Weight | 297.38 g/mol |
| Exact Mass | 297.11 |
| IUPAC Name | N'-[2-(benzenesulfonyl)ethyl]morpholine-4-carboximidamide |
| SMILES | N/C(=N\CCS(=O)(=O)c1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C13H19N3O3S/c14-13(16-7-9-19-10-8-16)15-6-11-20(17,18)12-4-2-1-3-5-12/h1-5H,6-11H2,(H2,14,15) |
| InChIKey | DYYVPNZVALKWOZ-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.38 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|