C15H23N3O3S — CID 111065176
N'-(3-benzylsulfonylpropyl)morpholine-4-carboximidamide (PubChem CID 111065176) has the molecular formula C15H23N3O3S and a molecular weight of 325.43 g/mol. Its IUPAC name is N'-(3-benzylsulfonylpropyl)morpholine-4-carboximidamide.
| Compound Name | N'-(3-benzylsulfonylpropyl)morpholine-4-carboximidamide |
|---|---|
| PubChem CID | 111065176 |
| Molecular Formula | C15H23N3O3S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.15 |
| IUPAC Name | N'-(3-benzylsulfonylpropyl)morpholine-4-carboximidamide |
| SMILES | N/C(=N\CCCS(=O)(=O)Cc1ccccc1)N1CCOCC1 |
| InChI | InChI=1S/C15H23N3O3S/c16-15(18-8-10-21-11-9-18)17-7-4-12-22(19,20)13-14-5-2-1-3-6-14/h1-3,5-6H,4,7-13H2,(H2,16,17) |
| InChIKey | SJTCLWUMVQWVSP-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 84.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|