C19H25FIN3O2S — CID 111307939
2-[2-(benzenesulfonyl)ethyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine;hydroiodide (PubChem CID 111307939) has the molecular formula C19H25FIN3O2S and a molecular weight of 505.40 g/mol. Its IUPAC name is 2-[2-(benzenesulfonyl)ethyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine;hydroiodide.
| Compound Name | 2-[2-(benzenesulfonyl)ethyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111307939 |
| Molecular Formula | C19H25FIN3O2S |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 505.07 |
| IUPAC Name | 2-[2-(benzenesulfonyl)ethyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine;hydroiodide |
| SMILES | CCN/C(=N\CCS(=O)(=O)c1ccccc1)N(C)Cc1ccc(F)cc1.I |
| InChI | InChI=1S/C19H24FN3O2S.HI/c1-3-21-19(23(2)15-16-9-11-17(20)12-10-16)22-13-14-26(24,25)18-7-5-4-6-8-18;/h4-12H,3,13-15H2,1-2H3,(H,21,22);1H |
| InChIKey | JUOBGEGPDCRNNX-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|