C20H26FN3O2S — CID 111306778
2-[3-(benzenesulfonyl)propyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine (PubChem CID 111306778) has the molecular formula C20H26FN3O2S and a molecular weight of 391.51 g/mol. Its IUPAC name is 2-[3-(benzenesulfonyl)propyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine.
| Compound Name | 2-[3-(benzenesulfonyl)propyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine |
|---|---|
| PubChem CID | 111306778 |
| Molecular Formula | C20H26FN3O2S |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.17 |
| IUPAC Name | 2-[3-(benzenesulfonyl)propyl]-3-ethyl-1-[(4-fluorophenyl)methyl]-1-methylguanidine |
| SMILES | CCN/C(=N\CCCS(=O)(=O)c1ccccc1)N(C)Cc1ccc(F)cc1 |
| InChI | InChI=1S/C20H26FN3O2S/c1-3-22-20(24(2)16-17-10-12-18(21)13-11-17)23-14-7-15-27(25,26)19-8-5-4-6-9-19/h4-6,8-13H,3,7,14-16H2,1-2H3,(H,22,23) |
| InChIKey | QLIKBGUJZMZCAX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|