C19H31N3O2S — CID 111758742
N'-[2-(4-tert-butylphenyl)sulfonylethyl]-N-ethylpyrrolidine-1-carboximidamide (PubChem CID 111758742) has the molecular formula C19H31N3O2S and a molecular weight of 365.54 g/mol. Its IUPAC name is N'-[2-(4-tert-butylphenyl)sulfonylethyl]-N-ethylpyrrolidine-1-carboximidamide.
| Compound Name | N'-[2-(4-tert-butylphenyl)sulfonylethyl]-N-ethylpyrrolidine-1-carboximidamide |
|---|---|
| PubChem CID | 111758742 |
| Molecular Formula | C19H31N3O2S |
| Molecular Weight | 365.54 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | N'-[2-(4-tert-butylphenyl)sulfonylethyl]-N-ethylpyrrolidine-1-carboximidamide |
| SMILES | CCN/C(=N\CCS(=O)(=O)c1ccc(C(C)(C)C)cc1)N1CCCC1 |
| InChI | InChI=1S/C19H31N3O2S/c1-5-20-18(22-13-6-7-14-22)21-12-15-25(23,24)17-10-8-16(9-11-17)19(2,3)4/h8-11H,5-7,12-15H2,1-4H3,(H,20,21) |
| InChIKey | DTBWPUWMBMMWHJ-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 61.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.54 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|