C12H17Cl2NO2S — CID 64675930
N-[2-(2,6-dichlorophenyl)sulfonylethyl]-2-methylpropan-2-amine (PubChem CID 64675930) has the molecular formula C12H17Cl2NO2S and a molecular weight of 310.25 g/mol. Its IUPAC name is N-[2-(2,6-dichlorophenyl)sulfonylethyl]-2-methylpropan-2-amine.
| Compound Name | N-[2-(2,6-dichlorophenyl)sulfonylethyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 64675930 |
| Molecular Formula | C12H17Cl2NO2S |
| Molecular Weight | 310.25 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | N-[2-(2,6-dichlorophenyl)sulfonylethyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCCS(=O)(=O)c1c(Cl)cccc1Cl |
| InChI | InChI=1S/C12H17Cl2NO2S/c1-12(2,3)15-7-8-18(16,17)11-9(13)5-4-6-10(11)14/h4-6,15H,7-8H2,1-3H3 |
| InChIKey | OPZITTXDILZXGS-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.25 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |