C13H20ClNO2S — CID 114792066
N-[2-[(4-chlorophenyl)methylsulfonyl]ethyl]-2-methylpropan-2-amine (PubChem CID 114792066) has the molecular formula C13H20ClNO2S and a molecular weight of 289.83 g/mol. Its IUPAC name is N-[2-[(4-chlorophenyl)methylsulfonyl]ethyl]-2-methylpropan-2-amine.
| Compound Name | N-[2-[(4-chlorophenyl)methylsulfonyl]ethyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 114792066 |
| Molecular Formula | C13H20ClNO2S |
| Molecular Weight | 289.83 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | N-[2-[(4-chlorophenyl)methylsulfonyl]ethyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCCS(=O)(=O)Cc1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H20ClNO2S/c1-13(2,3)15-8-9-18(16,17)10-11-4-6-12(14)7-5-11/h4-7,15H,8-10H2,1-3H3 |
| InChIKey | HUDZLNQZLMTJBM-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.83 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |