C17H20ClNO4S2 — CID 55905317
N-(3-benzylsulfonylpropyl)-4-chloro-2-methylbenzenesulfonamide (PubChem CID 55905317) has the molecular formula C17H20ClNO4S2 and a molecular weight of 401.94 g/mol. Its IUPAC name is N-(3-benzylsulfonylpropyl)-4-chloro-2-methylbenzenesulfonamide.
| Compound Name | N-(3-benzylsulfonylpropyl)-4-chloro-2-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 55905317 |
| Molecular Formula | C17H20ClNO4S2 |
| Molecular Weight | 401.94 g/mol |
| Exact Mass | 401.05 |
| IUPAC Name | N-(3-benzylsulfonylpropyl)-4-chloro-2-methylbenzenesulfonamide |
| SMILES | Cc1cc(Cl)ccc1S(=O)(=O)NCCCS(=O)(=O)Cc1ccccc1 |
| InChI | InChI=1S/C17H20ClNO4S2/c1-14-12-16(18)8-9-17(14)25(22,23)19-10-5-11-24(20,21)13-15-6-3-2-4-7-15/h2-4,6-9,12,19H,5,10-11,13H2,1H3 |
| InChIKey | QIWSOJSNTKGZRN-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.94 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|