C15H24ClNO3S — CID 114319785
N-[[2-chloro-6-(3-methylsulfonylpropoxy)phenyl]methyl]-2-methylpropan-2-amine (PubChem CID 114319785) has the molecular formula C15H24ClNO3S and a molecular weight of 333.88 g/mol. Its IUPAC name is N-[[2-chloro-6-(3-methylsulfonylpropoxy)phenyl]methyl]-2-methylpropan-2-amine.
| Compound Name | N-[[2-chloro-6-(3-methylsulfonylpropoxy)phenyl]methyl]-2-methylpropan-2-amine |
|---|---|
| PubChem CID | 114319785 |
| Molecular Formula | C15H24ClNO3S |
| Molecular Weight | 333.88 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | N-[[2-chloro-6-(3-methylsulfonylpropoxy)phenyl]methyl]-2-methylpropan-2-amine |
| SMILES | CC(C)(C)NCc1c(Cl)cccc1OCCCS(C)(=O)=O |
| InChI | InChI=1S/C15H24ClNO3S/c1-15(2,3)17-11-12-13(16)7-5-8-14(12)20-9-6-10-21(4,18)19/h5,7-8,17H,6,9-11H2,1-4H3 |
| InChIKey | FMQOJUOUPUCSAU-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.88 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|