C12H18ClNO3S — CID 112608503
1-[3-chloro-2-(3-methylsulfonylpropoxy)phenyl]-N-methylmethanamine (PubChem CID 112608503) has the molecular formula C12H18ClNO3S and a molecular weight of 291.80 g/mol. Its IUPAC name is 1-[3-chloro-2-(3-methylsulfonylpropoxy)phenyl]-N-methylmethanamine.
| Compound Name | 1-[3-chloro-2-(3-methylsulfonylpropoxy)phenyl]-N-methylmethanamine |
|---|---|
| PubChem CID | 112608503 |
| Molecular Formula | C12H18ClNO3S |
| Molecular Weight | 291.80 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 1-[3-chloro-2-(3-methylsulfonylpropoxy)phenyl]-N-methylmethanamine |
| SMILES | CNCc1cccc(Cl)c1OCCCS(C)(=O)=O |
| InChI | InChI=1S/C12H18ClNO3S/c1-14-9-10-5-3-6-11(13)12(10)17-7-4-8-18(2,15)16/h3,5-6,14H,4,7-9H2,1-2H3 |
| InChIKey | FYVRCDJNYJSZOF-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.80 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|