C12H30N2O6S2 — CID 161130574
2-(propan-2-ylamino)propane-1-sulfonic acid;3-(propan-2-ylamino)propane-1-sulfonic acid (PubChem CID 161130574) has the molecular formula C12H30N2O6S2 and a molecular weight of 362.51 g/mol. Its IUPAC name is 2-(propan-2-ylamino)propane-1-sulfonic acid;3-(propan-2-ylamino)propane-1-sulfonic acid.
| Compound Name | 2-(propan-2-ylamino)propane-1-sulfonic acid;3-(propan-2-ylamino)propane-1-sulfonic acid |
|---|---|
| PubChem CID | 161130574 |
| Molecular Formula | C12H30N2O6S2 |
| Molecular Weight | 362.51 g/mol |
| Exact Mass | 362.15 |
| IUPAC Name | 2-(propan-2-ylamino)propane-1-sulfonic acid;3-(propan-2-ylamino)propane-1-sulfonic acid |
| SMILES | CC(C)NC(C)CS(=O)(=O)O.CC(C)NCCCS(=O)(=O)O |
| InChI | InChI=1S/2C6H15NO3S/c1-5(2)7-6(3)4-11(8,9)10;1-6(2)7-4-3-5-11(8,9)10/h5-7H,4H2,1-3H3,(H,8,9,10);6-7H,3-5H2,1-2H3,(H,8,9,10) |
| InChIKey | UMCWXLPGMCHKRP-UHFFFAOYSA-N |
| XLogP | 0.52 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.51 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|