C7H19NO4S — CID 20512923
ethanesulfonic acid;2-(propan-2-ylamino)ethanol (PubChem CID 20512923) has the molecular formula C7H19NO4S and a molecular weight of 213.30 g/mol. Its IUPAC name is ethanesulfonic acid;2-(propan-2-ylamino)ethanol.
| Compound Name | ethanesulfonic acid;2-(propan-2-ylamino)ethanol |
|---|---|
| PubChem CID | 20512923 |
| Molecular Formula | C7H19NO4S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | ethanesulfonic acid;2-(propan-2-ylamino)ethanol |
| SMILES | CC(C)NCCO.CCS(=O)(=O)O |
| InChI | InChI=1S/C5H13NO.C2H6O3S/c1-5(2)6-3-4-7;1-2-6(3,4)5/h5-7H,3-4H2,1-2H3;2H2,1H3,(H,3,4,5) |
| InChIKey | ISASOEUIEAWFQC-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|