C6H15NO3 — CID 88937689
2-(1-hydroxyethylamino)butane-1,3-diol (PubChem CID 88937689) has the molecular formula C6H15NO3 and a molecular weight of 149.19 g/mol. Its IUPAC name is 2-(1-hydroxyethylamino)butane-1,3-diol.
| Compound Name | 2-(1-hydroxyethylamino)butane-1,3-diol |
|---|---|
| PubChem CID | 88937689 |
| Molecular Formula | C6H15NO3 |
| Molecular Weight | 149.19 g/mol |
| Exact Mass | 149.11 |
| IUPAC Name | 2-(1-hydroxyethylamino)butane-1,3-diol |
| SMILES | CC(O)NC(CO)C(C)O |
| InChI | InChI=1S/C6H15NO3/c1-4(9)6(3-8)7-5(2)10/h4-10H,3H2,1-2H3 |
| InChIKey | XXJFNVSOXDBNKC-UHFFFAOYSA-N |
| XLogP | -1.34 |
| TPSA | 72.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.19 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|