C8H21N3O2 — CID 174713923
1,3,4-tris(methylamino)pentane-1,5-diol (PubChem CID 174713923) has the molecular formula C8H21N3O2 and a molecular weight of 191.27 g/mol. Its IUPAC name is 1,3,4-tris(methylamino)pentane-1,5-diol.
| Compound Name | 1,3,4-tris(methylamino)pentane-1,5-diol |
|---|---|
| PubChem CID | 174713923 |
| Molecular Formula | C8H21N3O2 |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.16 |
| IUPAC Name | 1,3,4-tris(methylamino)pentane-1,5-diol |
| SMILES | CNC(O)CC(NC)C(CO)NC |
| InChI | InChI=1S/C8H21N3O2/c1-9-6(4-8(13)11-3)7(5-12)10-2/h6-13H,4-5H2,1-3H3 |
| InChIKey | BSAYKQZBRJNUEU-UHFFFAOYSA-N |
| XLogP | -1.92 |
| TPSA | 76.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|