C8H21N3O2 — CID 163597545
(1R,3S)-3,6-diamino-1-(methylamino)heptane-1,7-diol (PubChem CID 163597545) has the molecular formula C8H21N3O2 and a molecular weight of 191.27 g/mol. Its IUPAC name is (1R,3S)-3,6-diamino-1-(methylamino)heptane-1,7-diol.
| Compound Name | (1R,3S)-3,6-diamino-1-(methylamino)heptane-1,7-diol |
|---|---|
| PubChem CID | 163597545 |
| Molecular Formula | C8H21N3O2 |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.16 |
| IUPAC Name | (1R,3S)-3,6-diamino-1-(methylamino)heptane-1,7-diol |
| SMILES | CN[C@H](O)C[C@@H](N)CCC(N)CO |
| InChI | InChI=1S/C8H21N3O2/c1-11-8(13)4-6(9)2-3-7(10)5-12/h6-8,11-13H,2-5,9-10H2,1H3/t6-,7?,8+/m0/s1 |
| InChIKey | GUTUGXOCAXRYAK-YPVSKDHRSA-N |
| XLogP | -1.66 |
| TPSA | 104.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | -1.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|