C9H22N2O — CID 141295191
2,7-diaminononan-1-ol (PubChem CID 141295191) has the molecular formula C9H22N2O and a molecular weight of 174.29 g/mol. Its IUPAC name is 2,7-diaminononan-1-ol.
| Compound Name | 2,7-diaminononan-1-ol |
|---|---|
| PubChem CID | 141295191 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | 2,7-diaminononan-1-ol |
| SMILES | CCC(N)CCCCC(N)CO |
| InChI | InChI=1S/C9H22N2O/c1-2-8(10)5-3-4-6-9(11)7-12/h8-9,12H,2-7,10-11H2,1H3 |
| InChIKey | AEQORIAWLAZUQH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|