About 2,7-diaminononan-1-ol
2,7-diaminononan-1-ol (PubChem CID 141295191) has the molecular formula C9H22N2O
and a molecular weight of 174.29 g/mol. Its IUPAC name is 2,7-diaminononan-1-ol.
Molecular Properties
| Compound Name | 2,7-diaminononan-1-ol |
| PubChem CID | 141295191 |
| Molecular Formula | C9H22N2O |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.17 |
| IUPAC Name | 2,7-diaminononan-1-ol |
| SMILES | CCC(N)CCCCC(N)CO |
| InChI | InChI=1S/C9H22N2O/c1-2-8(10)5-3-4-6-9(11)7-12/h8-9,12H,2-7,10-11H2,1H3 |
| InChIKey | AEQORIAWLAZUQH-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 72.27 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,7-diaminononan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,7-diaminononan-1-ol?
The IUPAC name of 2,7-diaminononan-1-ol (CID 141295191) is 2,7-diaminononan-1-ol.
What is the SMILES notation for 2,7-diaminononan-1-ol?
The canonical SMILES for 2,7-diaminononan-1-ol is CCC(N)CCCCC(N)CO.
What is the InChIKey of 2,7-diaminononan-1-ol?
The InChIKey is AEQORIAWLAZUQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H22N2O/c1-2-8(10)5-3-4-6-9(11)7-12/h8-9,12H,2-7,10-11H2,1H3.
What are the key properties of 2,7-diaminononan-1-ol?
2,7-diaminononan-1-ol has a molecular weight of 174.29 g/mol, XLogP of 0.60, 7 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,7-diaminononan-1-ol is sourced from PubChem (CID 141295191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).