C7H17NO2 — CID 130023350
2-aminoheptane-1,5-diol (PubChem CID 130023350) has the molecular formula C7H17NO2 and a molecular weight of 147.22 g/mol. Its IUPAC name is 2-aminoheptane-1,5-diol.
| Compound Name | 2-aminoheptane-1,5-diol |
|---|---|
| PubChem CID | 130023350 |
| Molecular Formula | C7H17NO2 |
| Molecular Weight | 147.22 g/mol |
| Exact Mass | 147.13 |
| IUPAC Name | 2-aminoheptane-1,5-diol |
| SMILES | CCC(O)CCC(N)CO |
| InChI | InChI=1S/C7H17NO2/c1-2-7(10)4-3-6(8)5-9/h6-7,9-10H,2-5,8H2,1H3 |
| InChIKey | ROVDPYQQKRWXPZ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.22 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |