C9H24N2O3 — CID 172771084
(2S)-2,6-diaminohexan-1-ol;propane-1,2-diol (PubChem CID 172771084) has the molecular formula C9H24N2O3 and a molecular weight of 208.30 g/mol. Its IUPAC name is (2S)-2,6-diaminohexan-1-ol;propane-1,2-diol.
| Compound Name | (2S)-2,6-diaminohexan-1-ol;propane-1,2-diol |
|---|---|
| PubChem CID | 172771084 |
| Molecular Formula | C9H24N2O3 |
| Molecular Weight | 208.30 g/mol |
| Exact Mass | 208.18 |
| IUPAC Name | (2S)-2,6-diaminohexan-1-ol;propane-1,2-diol |
| SMILES | CC(O)CO.NCCCC[C@H](N)CO |
| InChI | InChI=1S/C6H16N2O.C3H8O2/c7-4-2-1-3-6(8)5-9;1-3(5)2-4/h6,9H,1-5,7-8H2;3-5H,2H2,1H3/t6-;/m0./s1 |
| InChIKey | MYPAEIGHLDOPLZ-RGMNGODLSA-N |
| XLogP | -1.21 |
| TPSA | 112.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.30 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|