C6H15NO2 — CID 90884823
2-(methylamino)pentane-1,4-diol (PubChem CID 90884823) has the molecular formula C6H15NO2 and a molecular weight of 133.19 g/mol. Its IUPAC name is 2-(methylamino)pentane-1,4-diol.
| Compound Name | 2-(methylamino)pentane-1,4-diol |
|---|---|
| PubChem CID | 90884823 |
| Molecular Formula | C6H15NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | 2-(methylamino)pentane-1,4-diol |
| SMILES | CNC(CO)CC(C)O |
| InChI | InChI=1S/C6H15NO2/c1-5(9)3-6(4-8)7-2/h5-9H,3-4H2,1-2H3 |
| InChIKey | JJKVIXZUUYPKBK-UHFFFAOYSA-N |
| XLogP | -0.66 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | -0.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |