About 2-(methylamino)pentane-1,3-diol;hydrobromide
2-(methylamino)pentane-1,3-diol;hydrobromide (PubChem CID 174751065) has the molecular formula C6H16BrNO2
and a molecular weight of 214.10 g/mol. Its IUPAC name is 2-(methylamino)pentane-1,3-diol;hydrobromide.
Molecular Properties
| Compound Name | 2-(methylamino)pentane-1,3-diol;hydrobromide |
| PubChem CID | 174751065 |
| Molecular Formula | C6H16BrNO2 |
| Molecular Weight | 214.10 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | 2-(methylamino)pentane-1,3-diol;hydrobromide |
| SMILES | Br.CCC(O)C(CO)NC |
| InChI | InChI=1S/C6H15NO2.BrH/c1-3-6(9)5(4-8)7-2;/h5-9H,3-4H2,1-2H3;1H |
| InChIKey | VAAFOHVZDAUDHN-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.10 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-(methylamino)pentane-1,3-diol;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(methylamino)pentane-1,3-diol;hydrobromide?
The IUPAC name of 2-(methylamino)pentane-1,3-diol;hydrobromide (CID 174751065) is 2-(methylamino)pentane-1,3-diol;hydrobromide.
What is the SMILES notation for 2-(methylamino)pentane-1,3-diol;hydrobromide?
The canonical SMILES for 2-(methylamino)pentane-1,3-diol;hydrobromide is Br.CCC(O)C(CO)NC.
What is the InChIKey of 2-(methylamino)pentane-1,3-diol;hydrobromide?
The InChIKey is VAAFOHVZDAUDHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15NO2.BrH/c1-3-6(9)5(4-8)7-2;/h5-9H,3-4H2,1-2H3;1H.
What are the key properties of 2-(methylamino)pentane-1,3-diol;hydrobromide?
2-(methylamino)pentane-1,3-diol;hydrobromide has a molecular weight of 214.10 g/mol, XLogP of -0.08, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(methylamino)pentane-1,3-diol;hydrobromide is sourced from PubChem (CID 174751065), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).