C9H21ClN2O2 — CID 87788313
4-[3-chloropropyl(methyl)amino]-2-(methylamino)butane-1,3-diol (PubChem CID 87788313) has the molecular formula C9H21ClN2O2 and a molecular weight of 224.73 g/mol. Its IUPAC name is 4-[3-chloropropyl(methyl)amino]-2-(methylamino)butane-1,3-diol.
| Compound Name | 4-[3-chloropropyl(methyl)amino]-2-(methylamino)butane-1,3-diol |
|---|---|
| PubChem CID | 87788313 |
| Molecular Formula | C9H21ClN2O2 |
| Molecular Weight | 224.73 g/mol |
| Exact Mass | 224.13 |
| IUPAC Name | 4-[3-chloropropyl(methyl)amino]-2-(methylamino)butane-1,3-diol |
| SMILES | CNC(CO)C(O)CN(C)CCCCl |
| InChI | InChI=1S/C9H21ClN2O2/c1-11-8(7-13)9(14)6-12(2)5-3-4-10/h8-9,11,13-14H,3-7H2,1-2H3 |
| InChIKey | UECBGUFFMNZUCU-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.73 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|