C8H20N2O2 — CID 82850479
3-[methyl-[3-(methylamino)propyl]amino]propane-1,2-diol (PubChem CID 82850479) has the molecular formula C8H20N2O2 and a molecular weight of 176.26 g/mol. Its IUPAC name is 3-[methyl-[3-(methylamino)propyl]amino]propane-1,2-diol.
| Compound Name | 3-[methyl-[3-(methylamino)propyl]amino]propane-1,2-diol |
|---|---|
| PubChem CID | 82850479 |
| Molecular Formula | C8H20N2O2 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.15 |
| IUPAC Name | 3-[methyl-[3-(methylamino)propyl]amino]propane-1,2-diol |
| SMILES | CNCCCN(C)CC(O)CO |
| InChI | InChI=1S/C8H20N2O2/c1-9-4-3-5-10(2)6-8(12)7-11/h8-9,11-12H,3-7H2,1-2H3 |
| InChIKey | GTZCNTBGBJFQOJ-UHFFFAOYSA-N |
| XLogP | -1.12 |
| TPSA | 55.73 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | -1.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|