About N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine
N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine (PubChem CID 156820952) has the molecular formula C10H24N2
and a molecular weight of 172.32 g/mol. Its IUPAC name is N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine.
Molecular Properties
| Compound Name | N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine |
| PubChem CID | 156820952 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine |
| SMILES | CNCNC(CC(C)C)C(C)C |
| InChI | InChI=1S/C10H24N2/c1-8(2)6-10(9(3)4)12-7-11-5/h8-12H,6-7H2,1-5H3 |
| InChIKey | CACIEGVDIAKTRI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine?
The IUPAC name of N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine (CID 156820952) is N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine.
What is the SMILES notation for N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine?
The canonical SMILES for N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine is CNCNC(CC(C)C)C(C)C.
What is the InChIKey of N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine?
The InChIKey is CACIEGVDIAKTRI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H24N2/c1-8(2)6-10(9(3)4)12-7-11-5/h8-12H,6-7H2,1-5H3.
What are the key properties of N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine?
N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine has a molecular weight of 172.32 g/mol, XLogP of 1.82, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine is sourced from PubChem (CID 156820952), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).