C10H24N2 — CID 156820952
N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine (PubChem CID 156820952) has the molecular formula C10H24N2 and a molecular weight of 172.32 g/mol. Its IUPAC name is N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine.
| Compound Name | N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine |
|---|---|
| PubChem CID | 156820952 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | N'-(2,5-dimethylhexan-3-yl)-N-methylmethanediamine |
| SMILES | CNCNC(CC(C)C)C(C)C |
| InChI | InChI=1S/C10H24N2/c1-8(2)6-10(9(3)4)12-7-11-5/h8-12H,6-7H2,1-5H3 |
| InChIKey | CACIEGVDIAKTRI-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|