C13H30N2 — CID 160646348
3-methyl-1-N,1-N'-bis(2-methylpropyl)butane-1,1-diamine (PubChem CID 160646348) has the molecular formula C13H30N2 and a molecular weight of 214.40 g/mol. Its IUPAC name is 3-methyl-1-N,1-N'-bis(2-methylpropyl)butane-1,1-diamine.
| Compound Name | 3-methyl-1-N,1-N'-bis(2-methylpropyl)butane-1,1-diamine |
|---|---|
| PubChem CID | 160646348 |
| Molecular Formula | C13H30N2 |
| Molecular Weight | 214.40 g/mol |
| Exact Mass | 214.24 |
| IUPAC Name | 3-methyl-1-N,1-N'-bis(2-methylpropyl)butane-1,1-diamine |
| SMILES | CC(C)CNC(CC(C)C)NCC(C)C |
| InChI | InChI=1S/C13H30N2/c1-10(2)7-13(14-8-11(3)4)15-9-12(5)6/h10-15H,7-9H2,1-6H3 |
| InChIKey | LJBSIJNKUJZSPW-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.40 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|