C6H16N2 — CID 90182021
1-N'-(2-methylpropyl)ethane-1,1-diamine (PubChem CID 90182021) has the molecular formula C6H16N2 and a molecular weight of 116.21 g/mol. Its IUPAC name is 1-N'-(2-methylpropyl)ethane-1,1-diamine.
| Compound Name | 1-N'-(2-methylpropyl)ethane-1,1-diamine |
|---|---|
| PubChem CID | 90182021 |
| Molecular Formula | C6H16N2 |
| Molecular Weight | 116.21 g/mol |
| Exact Mass | 116.13 |
| IUPAC Name | 1-N'-(2-methylpropyl)ethane-1,1-diamine |
| SMILES | CC(C)CNC(C)N |
| InChI | InChI=1S/C6H16N2/c1-5(2)4-8-6(3)7/h5-6,8H,4,7H2,1-3H3 |
| InChIKey | LZKSTLZTBQJTKJ-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.21 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|