C12H30N4O2 — CID 118555473
1,4-diamino-1,4-bis(2-methylpropylamino)butane-2,3-diol (PubChem CID 118555473) has the molecular formula C12H30N4O2 and a molecular weight of 262.40 g/mol. Its IUPAC name is 1,4-diamino-1,4-bis(2-methylpropylamino)butane-2,3-diol.
| Compound Name | 1,4-diamino-1,4-bis(2-methylpropylamino)butane-2,3-diol |
|---|---|
| PubChem CID | 118555473 |
| Molecular Formula | C12H30N4O2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.24 |
| IUPAC Name | 1,4-diamino-1,4-bis(2-methylpropylamino)butane-2,3-diol |
| SMILES | CC(C)CNC(N)C(O)C(O)C(N)NCC(C)C |
| InChI | InChI=1S/C12H30N4O2/c1-7(2)5-15-11(13)9(17)10(18)12(14)16-6-8(3)4/h7-12,15-18H,5-6,13-14H2,1-4H3 |
| InChIKey | DODKWSDGANVIOJ-UHFFFAOYSA-N |
| XLogP | -1.23 |
| TPSA | 116.56 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | -1.23 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|