C14H35Cl2N3 — CID 87961694
1-N',6-N-bis(2-methylpropyl)hexane-1,1,6-triamine;dihydrochloride (PubChem CID 87961694) has the molecular formula C14H35Cl2N3 and a molecular weight of 316.36 g/mol. Its IUPAC name is 1-N',6-N-bis(2-methylpropyl)hexane-1,1,6-triamine;dihydrochloride.
| Compound Name | 1-N',6-N-bis(2-methylpropyl)hexane-1,1,6-triamine;dihydrochloride |
|---|---|
| PubChem CID | 87961694 |
| Molecular Formula | C14H35Cl2N3 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 315.22 |
| IUPAC Name | 1-N',6-N-bis(2-methylpropyl)hexane-1,1,6-triamine;dihydrochloride |
| SMILES | CC(C)CNCCCCCC(N)NCC(C)C.Cl.Cl |
| InChI | InChI=1S/C14H33N3.2ClH/c1-12(2)10-16-9-7-5-6-8-14(15)17-11-13(3)4;;/h12-14,16-17H,5-11,15H2,1-4H3;2*1H |
| InChIKey | GNKQKGJOIOTWRL-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|