C10H24N2 — CID 105282806
2,3,6-trimethylheptan-4-ylhydrazine (PubChem CID 105282806) has the molecular formula C10H24N2 and a molecular weight of 172.32 g/mol. Its IUPAC name is 2,3,6-trimethylheptan-4-ylhydrazine.
| Compound Name | 2,3,6-trimethylheptan-4-ylhydrazine |
|---|---|
| PubChem CID | 105282806 |
| Molecular Formula | C10H24N2 |
| Molecular Weight | 172.32 g/mol |
| Exact Mass | 172.19 |
| IUPAC Name | 2,3,6-trimethylheptan-4-ylhydrazine |
| SMILES | CC(C)CC(NN)C(C)C(C)C |
| InChI | InChI=1S/C10H24N2/c1-7(2)6-10(12-11)9(5)8(3)4/h7-10,12H,6,11H2,1-5H3 |
| InChIKey | CIFXCZXALCOSTL-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|