C11H26N2O2S — CID 105310922
(1-ethylsulfonyl-5,6-dimethylheptan-4-yl)hydrazine (PubChem CID 105310922) has the molecular formula C11H26N2O2S and a molecular weight of 250.41 g/mol. Its IUPAC name is (1-ethylsulfonyl-5,6-dimethylheptan-4-yl)hydrazine.
| Compound Name | (1-ethylsulfonyl-5,6-dimethylheptan-4-yl)hydrazine |
|---|---|
| PubChem CID | 105310922 |
| Molecular Formula | C11H26N2O2S |
| Molecular Weight | 250.41 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (1-ethylsulfonyl-5,6-dimethylheptan-4-yl)hydrazine |
| SMILES | CCS(=O)(=O)CCCC(NN)C(C)C(C)C |
| InChI | InChI=1S/C11H26N2O2S/c1-5-16(14,15)8-6-7-11(13-12)10(4)9(2)3/h9-11,13H,5-8,12H2,1-4H3 |
| InChIKey | JBGSNALCMTVLMB-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.41 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|