C15H33NO3S — CID 116725019
1-ethylsulfonyl-5-methoxy-6,6-dimethyl-N-propylheptan-4-amine (PubChem CID 116725019) has the molecular formula C15H33NO3S and a molecular weight of 307.50 g/mol. Its IUPAC name is 1-ethylsulfonyl-5-methoxy-6,6-dimethyl-N-propylheptan-4-amine.
| Compound Name | 1-ethylsulfonyl-5-methoxy-6,6-dimethyl-N-propylheptan-4-amine |
|---|---|
| PubChem CID | 116725019 |
| Molecular Formula | C15H33NO3S |
| Molecular Weight | 307.50 g/mol |
| Exact Mass | 307.22 |
| IUPAC Name | 1-ethylsulfonyl-5-methoxy-6,6-dimethyl-N-propylheptan-4-amine |
| SMILES | CCCNC(CCCS(=O)(=O)CC)C(OC)C(C)(C)C |
| InChI | InChI=1S/C15H33NO3S/c1-7-11-16-13(14(19-6)15(3,4)5)10-9-12-20(17,18)8-2/h13-14,16H,7-12H2,1-6H3 |
| InChIKey | DPWFRWAOMTWLBU-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.50 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |