C17H37NO2 — CID 103036085
3-ethoxy-7-methoxy-2,2,7-trimethyl-N-propyloctan-4-amine (PubChem CID 103036085) has the molecular formula C17H37NO2 and a molecular weight of 287.49 g/mol. Its IUPAC name is 3-ethoxy-7-methoxy-2,2,7-trimethyl-N-propyloctan-4-amine.
| Compound Name | 3-ethoxy-7-methoxy-2,2,7-trimethyl-N-propyloctan-4-amine |
|---|---|
| PubChem CID | 103036085 |
| Molecular Formula | C17H37NO2 |
| Molecular Weight | 287.49 g/mol |
| Exact Mass | 287.28 |
| IUPAC Name | 3-ethoxy-7-methoxy-2,2,7-trimethyl-N-propyloctan-4-amine |
| SMILES | CCCNC(CCC(C)(C)OC)C(OCC)C(C)(C)C |
| InChI | InChI=1S/C17H37NO2/c1-9-13-18-14(11-12-17(6,7)19-8)15(20-10-2)16(3,4)5/h14-15,18H,9-13H2,1-8H3 |
| InChIKey | YLEXGYHVWMXGTL-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.49 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |