C15H30F3NO — CID 116726022
3-ethoxy-8,8,8-trifluoro-2,2-dimethyl-N-propyloctan-4-amine (PubChem CID 116726022) has the molecular formula C15H30F3NO and a molecular weight of 297.40 g/mol. Its IUPAC name is 3-ethoxy-8,8,8-trifluoro-2,2-dimethyl-N-propyloctan-4-amine.
| Compound Name | 3-ethoxy-8,8,8-trifluoro-2,2-dimethyl-N-propyloctan-4-amine |
|---|---|
| PubChem CID | 116726022 |
| Molecular Formula | C15H30F3NO |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.23 |
| IUPAC Name | 3-ethoxy-8,8,8-trifluoro-2,2-dimethyl-N-propyloctan-4-amine |
| SMILES | CCCNC(CCCC(F)(F)F)C(OCC)C(C)(C)C |
| InChI | InChI=1S/C15H30F3NO/c1-6-11-19-12(9-8-10-15(16,17)18)13(20-7-2)14(3,4)5/h12-13,19H,6-11H2,1-5H3 |
| InChIKey | QHCAOHLJSQHXRB-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |