C18H37NO2 — CID 116726030
5-ethoxy-6,6-dimethyl-1-(oxolan-2-yl)-N-propylheptan-4-amine (PubChem CID 116726030) has the molecular formula C18H37NO2 and a molecular weight of 299.50 g/mol. Its IUPAC name is 5-ethoxy-6,6-dimethyl-1-(oxolan-2-yl)-N-propylheptan-4-amine.
| Compound Name | 5-ethoxy-6,6-dimethyl-1-(oxolan-2-yl)-N-propylheptan-4-amine |
|---|---|
| PubChem CID | 116726030 |
| Molecular Formula | C18H37NO2 |
| Molecular Weight | 299.50 g/mol |
| Exact Mass | 299.28 |
| IUPAC Name | 5-ethoxy-6,6-dimethyl-1-(oxolan-2-yl)-N-propylheptan-4-amine |
| SMILES | CCCNC(CCCC1CCCO1)C(OCC)C(C)(C)C |
| InChI | InChI=1S/C18H37NO2/c1-6-13-19-16(17(20-7-2)18(3,4)5)12-8-10-15-11-9-14-21-15/h15-17,19H,6-14H2,1-5H3 |
| InChIKey | CWIDYHYWQDZXNP-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |