C13H28N2O3 — CID 105246420
[1,1-diethoxy-5-(oxolan-2-yl)pentan-2-yl]hydrazine (PubChem CID 105246420) has the molecular formula C13H28N2O3 and a molecular weight of 260.38 g/mol. Its IUPAC name is [1,1-diethoxy-5-(oxolan-2-yl)pentan-2-yl]hydrazine.
| Compound Name | [1,1-diethoxy-5-(oxolan-2-yl)pentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105246420 |
| Molecular Formula | C13H28N2O3 |
| Molecular Weight | 260.38 g/mol |
| Exact Mass | 260.21 |
| IUPAC Name | [1,1-diethoxy-5-(oxolan-2-yl)pentan-2-yl]hydrazine |
| SMILES | CCOC(OCC)C(CCCC1CCCO1)NN |
| InChI | InChI=1S/C13H28N2O3/c1-3-16-13(17-4-2)12(15-14)9-5-7-11-8-6-10-18-11/h11-13,15H,3-10,14H2,1-2H3 |
| InChIKey | KREXJJDHDOYLTD-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 65.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.38 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|