C12H24F3NO — CID 113327134
7,7,7-trifluoro-2-methoxy-2-methyl-N-propylheptan-3-amine (PubChem CID 113327134) has the molecular formula C12H24F3NO and a molecular weight of 255.32 g/mol. Its IUPAC name is 7,7,7-trifluoro-2-methoxy-2-methyl-N-propylheptan-3-amine.
| Compound Name | 7,7,7-trifluoro-2-methoxy-2-methyl-N-propylheptan-3-amine |
|---|---|
| PubChem CID | 113327134 |
| Molecular Formula | C12H24F3NO |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.18 |
| IUPAC Name | 7,7,7-trifluoro-2-methoxy-2-methyl-N-propylheptan-3-amine |
| SMILES | CCCNC(CCCC(F)(F)F)C(C)(C)OC |
| InChI | InChI=1S/C12H24F3NO/c1-5-9-16-10(11(2,3)17-4)7-6-8-12(13,14)15/h10,16H,5-9H2,1-4H3 |
| InChIKey | KCQWYAZWFDZZCY-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |