C10H20F3NO — CID 115517311
7,7,7-trifluoro-2-methoxy-N,2-dimethylheptan-3-amine (PubChem CID 115517311) has the molecular formula C10H20F3NO and a molecular weight of 227.27 g/mol. Its IUPAC name is 7,7,7-trifluoro-2-methoxy-N,2-dimethylheptan-3-amine.
| Compound Name | 7,7,7-trifluoro-2-methoxy-N,2-dimethylheptan-3-amine |
|---|---|
| PubChem CID | 115517311 |
| Molecular Formula | C10H20F3NO |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.15 |
| IUPAC Name | 7,7,7-trifluoro-2-methoxy-N,2-dimethylheptan-3-amine |
| SMILES | CNC(CCCC(F)(F)F)C(C)(C)OC |
| InChI | InChI=1S/C10H20F3NO/c1-9(2,15-4)8(14-3)6-5-7-10(11,12)13/h8,14H,5-7H2,1-4H3 |
| InChIKey | VYSMXKCOULKYII-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |