C15H31NO — CID 114476002
3-methoxy-2,2,7-trimethyl-N-propyloct-7-en-4-amine (PubChem CID 114476002) has the molecular formula C15H31NO and a molecular weight of 241.42 g/mol. Its IUPAC name is 3-methoxy-2,2,7-trimethyl-N-propyloct-7-en-4-amine.
| Compound Name | 3-methoxy-2,2,7-trimethyl-N-propyloct-7-en-4-amine |
|---|---|
| PubChem CID | 114476002 |
| Molecular Formula | C15H31NO |
| Molecular Weight | 241.42 g/mol |
| Exact Mass | 241.24 |
| IUPAC Name | 3-methoxy-2,2,7-trimethyl-N-propyloct-7-en-4-amine |
| SMILES | C=C(C)CCC(NCCC)C(OC)C(C)(C)C |
| InChI | InChI=1S/C15H31NO/c1-8-11-16-13(10-9-12(2)3)14(17-7)15(4,5)6/h13-14,16H,2,8-11H2,1,3-7H3 |
| InChIKey | JVCFUUUTLAOSOW-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.42 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|