C13H30N2O3S — CID 105273689
(5-ethoxy-1-ethylsulfonyl-6,6-dimethylheptan-4-yl)hydrazine (PubChem CID 105273689) has the molecular formula C13H30N2O3S and a molecular weight of 294.46 g/mol. Its IUPAC name is (5-ethoxy-1-ethylsulfonyl-6,6-dimethylheptan-4-yl)hydrazine.
| Compound Name | (5-ethoxy-1-ethylsulfonyl-6,6-dimethylheptan-4-yl)hydrazine |
|---|---|
| PubChem CID | 105273689 |
| Molecular Formula | C13H30N2O3S |
| Molecular Weight | 294.46 g/mol |
| Exact Mass | 294.20 |
| IUPAC Name | (5-ethoxy-1-ethylsulfonyl-6,6-dimethylheptan-4-yl)hydrazine |
| SMILES | CCOC(C(CCCS(=O)(=O)CC)NN)C(C)(C)C |
| InChI | InChI=1S/C13H30N2O3S/c1-6-18-12(13(3,4)5)11(15-14)9-8-10-19(16,17)7-2/h11-12,15H,6-10,14H2,1-5H3 |
| InChIKey | YNGVEGTXZJSYOD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.46 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|