C11H26N2O3S — CID 105310977
[5-ethylsulfonyl-1-[(2-methylpropan-2-yl)oxy]pentan-2-yl]hydrazine (PubChem CID 105310977) has the molecular formula C11H26N2O3S and a molecular weight of 266.41 g/mol. Its IUPAC name is [5-ethylsulfonyl-1-[(2-methylpropan-2-yl)oxy]pentan-2-yl]hydrazine.
| Compound Name | [5-ethylsulfonyl-1-[(2-methylpropan-2-yl)oxy]pentan-2-yl]hydrazine |
|---|---|
| PubChem CID | 105310977 |
| Molecular Formula | C11H26N2O3S |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.17 |
| IUPAC Name | [5-ethylsulfonyl-1-[(2-methylpropan-2-yl)oxy]pentan-2-yl]hydrazine |
| SMILES | CCS(=O)(=O)CCCC(COC(C)(C)C)NN |
| InChI | InChI=1S/C11H26N2O3S/c1-5-17(14,15)8-6-7-10(13-12)9-16-11(2,3)4/h10,13H,5-9,12H2,1-4H3 |
| InChIKey | VQMPKRLZSZXTSW-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|