C15H33NO2S — CID 65097308
8-ethylsulfonyl-2,2-dimethyl-N-propyloctan-3-amine (PubChem CID 65097308) has the molecular formula C15H33NO2S and a molecular weight of 291.50 g/mol. Its IUPAC name is 8-ethylsulfonyl-2,2-dimethyl-N-propyloctan-3-amine.
| Compound Name | 8-ethylsulfonyl-2,2-dimethyl-N-propyloctan-3-amine |
|---|---|
| PubChem CID | 65097308 |
| Molecular Formula | C15H33NO2S |
| Molecular Weight | 291.50 g/mol |
| Exact Mass | 291.22 |
| IUPAC Name | 8-ethylsulfonyl-2,2-dimethyl-N-propyloctan-3-amine |
| SMILES | CCCNC(CCCCCS(=O)(=O)CC)C(C)(C)C |
| InChI | InChI=1S/C15H33NO2S/c1-6-12-16-14(15(3,4)5)11-9-8-10-13-19(17,18)7-2/h14,16H,6-13H2,1-5H3 |
| InChIKey | FEQJEFJAXRRTKG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.50 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|