C12H27NO2S — CID 107758506
N,3,3-trimethyl-1-pentylsulfonylbutan-2-amine (PubChem CID 107758506) has the molecular formula C12H27NO2S and a molecular weight of 249.42 g/mol. Its IUPAC name is N,3,3-trimethyl-1-pentylsulfonylbutan-2-amine.
| Compound Name | N,3,3-trimethyl-1-pentylsulfonylbutan-2-amine |
|---|---|
| PubChem CID | 107758506 |
| Molecular Formula | C12H27NO2S |
| Molecular Weight | 249.42 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | N,3,3-trimethyl-1-pentylsulfonylbutan-2-amine |
| SMILES | CCCCCS(=O)(=O)CC(NC)C(C)(C)C |
| InChI | InChI=1S/C12H27NO2S/c1-6-7-8-9-16(14,15)10-11(13-5)12(2,3)4/h11,13H,6-10H2,1-5H3 |
| InChIKey | YQFKZBBOUFFLOG-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.42 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|